20-Hete
From DrugPedia: A Wikipedia for Drug discovery
(Difference between revisions)
m (1 revision) |
|||
| (2 intermediate revisions not shown.) | |||
| Line 1: | Line 1: | ||
| - | |||
| - | |||
<table align='right' border=1> | <table align='right' border=1> | ||
<tr><td> | <tr><td> | ||
| Line 11: | Line 9: | ||
</jmol> | </jmol> | ||
</td></tr></table> | </td></tr></table> | ||
| - | == | + | [http://crdd.osdd.net/raghava/hmrbase/test_extract.php?&db=arun&table=nphormonet&id=1361&show=SHOW-3D Show 3-D Structure] |
| - | + | ||
| + | {{Drugbox | ||
| + | | IUPAC_name = (5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoic acid | ||
| + | | CAS_number = | ||
| + | | CAS_supplemental = | ||
| + | | ATC_suffix = | ||
| + | | ATC_supplemental = | ||
| + | | PubChem = 5283157 | ||
| + | | DrugBank = | ||
| + | | ChemSpiderID = | ||
| + | | chemical_formula = C<sub>20</sub>H<sub>32</sub>O<sub>3</sub> | ||
| + | | molecular_weight = 320.47 | ||
| + | | smiles = C(CCC=CCC=CCC=CCC=CCCCC(=O)O)CCO | ||
| + | | synonyms = 20-Hydroxyeicosatetraenoic acid | ||
| + | | density = | ||
| + | | melting_point = | ||
| + | | boiling_point = | ||
| + | | solubility = | ||
| + | | specific_rotation = | ||
| + | | sec_combustion = | ||
| + | | bioavailability = | ||
| + | | protein_bound = | ||
| + | | metabolism = | ||
| + | | elimination_half-life = | ||
| + | | excretion = | ||
| + | | pregnancy_category= | ||
| + | | dependency_liability = | ||
| + | | routes_of_administration = | ||
| + | }} | ||
| + | |||
| + | Stimulator of renal sodium, potassium atpase; RN given is for the (all-Z) isomer | ||
| + | |||
==General Properties== | ==General Properties== | ||
| Line 56: | Line 85: | ||
| - | [[ | + | [[Category:Hormones]] |
| + | [[Category:HMRbase]] | ||
Current revision
|
|
| 20-Hete
| |
| Systematic (IUPAC) name | |
| (5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoic acid | |
| Identifiers | |
| CAS number | ? |
| ATC code | ? |
| PubChem | |
| Chemical data | |
| Formula | C20H32O3 |
| Mol. mass | 320.47 |
| SMILES | & |
| Synonyms | 20-Hydroxyeicosatetraenoic acid |
| Pharmacokinetic data | |
| Bioavailability | ? |
| Metabolism | ? |
| Half life | ? |
| Excretion | ? |
| Therapeutic considerations | |
| Pregnancy cat. |
? |
| Legal status | |
| Routes | ? |
Stimulator of renal sodium, potassium atpase; RN given is for the (all-Z) isomer
[edit] General Properties
*Molecular Weight
320.47
*Molecular Formula
C20H32O3
*IUPAC NAME
(5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoic acid
*Canonical Smiles
C(CCC=CCC=CCC=CCC=CCCCC(=O)O)CCO
*Isomeric Smiles
C(CCC=C/CC=C/CC=C/CC=C/CCCC(=O)O)CCO
[edit] PhysioChemical Properties
*Melting Point
*LogP
*Water Solubility
