Leukotriene E4
From DrugPedia: A Wikipedia for Drug discovery
(Difference between revisions)
| (One intermediate revision not shown.) | |||
| Line 9: | Line 9: | ||
</jmol> | </jmol> | ||
</td></tr></table> | </td></tr></table> | ||
| - | |||
[http://crdd.osdd.net/raghava/hmrbase/test_extract.php?&db=arun&table=nphormonet&id=1358&show=SHOW-3D Show 3-D Structure] | [http://crdd.osdd.net/raghava/hmrbase/test_extract.php?&db=arun&table=nphormonet&id=1358&show=SHOW-3D Show 3-D Structure] | ||
| + | |||
| + | {{Drugbox | ||
| + | | IUPAC_name = (5S,6R,7E,9E,11Z,14Z)-6-[(2R)-2-amino-3-hydroxy-3-oxopropyl]sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid | ||
| + | | CAS_number = 75715-89-8 | ||
| + | | CAS_supplemental = | ||
| + | | ATC_suffix = | ||
| + | | ATC_supplemental = | ||
| + | | PubChem = 5280879 | ||
| + | | DrugBank = | ||
| + | | ChemSpiderID = | ||
| + | | chemical_formula = C<sub>23</sub>H<sub>37</sub>NO<sub>5</sub>S | ||
| + | | molecular_weight = 439.61 | ||
| + | | smiles = CCCCCC=CCC=CC=CC=CC(C(CCCC(=O)O)O)SCC(C(=O)O)N | ||
| + | | synonyms = LTE4 | ||
| + | | density = | ||
| + | | melting_point = | ||
| + | | boiling_point = | ||
| + | | solubility = | ||
| + | | specific_rotation = | ||
| + | | sec_combustion = | ||
| + | | bioavailability = | ||
| + | | protein_bound = | ||
| + | | metabolism = | ||
| + | | elimination_half-life = | ||
| + | | excretion = | ||
| + | | pregnancy_category= | ||
| + | | dependency_liability = | ||
| + | | routes_of_administration = | ||
| + | }} | ||
A biologically active principle of SRS-A that is formed from LEUKOTRIENE D4 via a peptidase reaction that removes the glycine residue. The biological actions of LTE4 are similar to LTC4 and LTD4. (From Dictionary of Prostaglandins and Related Compounds, 1990) | A biologically active principle of SRS-A that is formed from LEUKOTRIENE D4 via a peptidase reaction that removes the glycine residue. The biological actions of LTE4 are similar to LTC4 and LTD4. (From Dictionary of Prostaglandins and Related Compounds, 1990) | ||
| + | |||
==General Properties== | ==General Properties== | ||
| Line 47: | Line 76: | ||
<b>*Water Solubility</b> | <b>*Water Solubility</b> | ||
| - | |||
| - | |||
==External Links== | ==External Links== | ||
| Line 54: | Line 81: | ||
*[http://www.genome.jp/dbget-bin/www_bget?compound+C05952]KEGG Compound | *[http://www.genome.jp/dbget-bin/www_bget?compound+C05952]KEGG Compound | ||
| - | + | [[Category:Hormones]] | |
| - | [[ | + | [[Category:HMRbase]] |
Current revision
|
|
| Leukotriene E4
| |
| Systematic (IUPAC) name | |
| (5S,6R,7E,9E,11Z,14Z)-6-[(2R)-2-amino-3-hydroxy-3-oxopropyl]sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid | |
| Identifiers | |
| CAS number | |
| ATC code | ? |
| PubChem | |
| Chemical data | |
| Formula | C23H37NO5S |
| Mol. mass | 439.61 |
| SMILES | & |
| Synonyms | LTE4 |
| Pharmacokinetic data | |
| Bioavailability | ? |
| Metabolism | ? |
| Half life | ? |
| Excretion | ? |
| Therapeutic considerations | |
| Pregnancy cat. |
? |
| Legal status | |
| Routes | ? |
A biologically active principle of SRS-A that is formed from LEUKOTRIENE D4 via a peptidase reaction that removes the glycine residue. The biological actions of LTE4 are similar to LTC4 and LTD4. (From Dictionary of Prostaglandins and Related Compounds, 1990)
[edit] General Properties
*Molecular Weight
439.61
*Molecular Formula
C23H37NO5S
*IUPAC NAME
(5S,6R,7E,9E,11Z,14Z)-6-[(2R)-2-amino-3-hydroxy-3-oxopropyl]sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid
*Canonical Smiles
CCCCCC=CCC=CC=CC=CC(C(CCCC(=O)O)O)SCC(C(=O)O)N
*Isomeric Smiles
CCCCCC=C/CC=C/C=C/C=C/[C@H]([C@H](CCCC(=O)O)O)SC[C@@H](C(=O)O)N
[edit] PhysioChemical Properties
*Melting Point
*LogP
*Water Solubility
