Codeine methyl ether
From DrugPedia: A Wikipedia for Drug discovery
m |
(→Description) |
||
| (One intermediate revision not shown.) | |||
| Line 25: | Line 25: | ||
==Description== | ==Description== | ||
| + | Codeine is widely used as an analgesic and is the methyl ether of morphine. While it occurs naturally in opium to a small extent, it has been prepared synthetically by methylation of the phenolic hydroxyl group in morphine. Thus, it is known to prepare codeine by the reaction of morphine with a methylating agent such as dimethyl sulfate or trimethylphenyl ammonium ethoxide or trimethylphenyl ammonium hydroxide in the presence of a base such as aqueous sodium hydroxide, or alcoholic sodium ethoxide. | ||
==General Properties== | ==General Properties== | ||
Current revision
| Codeine methyl ether
| |
| Systematic (IUPAC) name | |
| N/A | |
| Identifiers | |
| CAS number | ? |
| ATC code | ? |
| PubChem | |
| Chemical data | |
| Formula | C19H23NO3 |
| Mol. mass | 313.39082 |
| SMILES | & |
| Pharmacokinetic data | |
| Bioavailability | ? |
| Metabolism | ? |
| Half life | ? |
| Excretion | ? |
| Therapeutic considerations | |
| Pregnancy cat. |
? |
| Legal status | |
| Routes | ? |
[edit] Description
Codeine is widely used as an analgesic and is the methyl ether of morphine. While it occurs naturally in opium to a small extent, it has been prepared synthetically by methylation of the phenolic hydroxyl group in morphine. Thus, it is known to prepare codeine by the reaction of morphine with a methylating agent such as dimethyl sulfate or trimethylphenyl ammonium ethoxide or trimethylphenyl ammonium hydroxide in the presence of a base such as aqueous sodium hydroxide, or alcoholic sodium ethoxide.
[edit] General Properties
*Molecular Weight
313.39082
*Molecular Formula
C19H23NO3
*IUPAC NAME
N/A
*Canonical Smiles
CN1CCC23C4C1CC5=C2C(=C(C=C5)OC)OC3C(C=C4)OC
*Isomeric Smiles
CN1CC[C@]23C4C1CC5=C2C(=C(C=C5)OC)O[C@H]3[C@H](C=C4)OC
*XLogP
1.6
*Topological Polar Surface Area
30.9
