Norbuprenorphine
From DrugPedia: A Wikipedia for Drug discovery
m (1 revision) |
(→Description) |
||
| Line 24: | Line 24: | ||
==Description== | ==Description== | ||
| - | metabolite of buprenorphine found in urine and feces; RN given refers to (5alpha,7alpha)-isomer; | + | metabolite of buprenorphine found in urine and feces; RN given refers to (5alpha,7alpha)-isomer; |
| + | |||
| + | Norbuprenorphine is the active, dealkylated metabolite of buprenorphine. However, it has a slightly different binding profile to opioid receptors, acting as a stronger partial agonist at the mu opioid receptor than buprenorphine itself, as well as being a potent full agonist for the nociceptin receptor.[1] Although Norbuprenorphine is a stronger metabolite than Buprenorphine, it does not readily cross the blood brain barrier. | ||
==General Properties== | ==General Properties== | ||
Current revision
| Norbuprenorphine
| |
| Systematic (IUPAC) name | |
| N/A | |
| Identifiers | |
| CAS number | ? |
| ATC code | ? |
| PubChem | |
| Chemical data | |
| Formula | C25H35NO4 |
| Mol. mass | 413.5497 |
| SMILES | & |
| Pharmacokinetic data | |
| Bioavailability | ? |
| Metabolism | ? |
| Half life | ? |
| Excretion | ? |
| Therapeutic considerations | |
| Pregnancy cat. |
? |
| Legal status | |
| Routes | ? |
[edit] Description
metabolite of buprenorphine found in urine and feces; RN given refers to (5alpha,7alpha)-isomer;
Norbuprenorphine is the active, dealkylated metabolite of buprenorphine. However, it has a slightly different binding profile to opioid receptors, acting as a stronger partial agonist at the mu opioid receptor than buprenorphine itself, as well as being a potent full agonist for the nociceptin receptor.[1] Although Norbuprenorphine is a stronger metabolite than Buprenorphine, it does not readily cross the blood brain barrier.
[edit] General Properties
*Molecular Weight
413.5497
*Molecular Formula
C25H35NO4
*IUPAC NAME
N/A
*Canonical Smiles
CC(C)(C)C(C)(C1CC23CCC1(C4C25CCNC3CC6=C5C(=C(C=C6)O)O4)OC)O
*Isomeric Smiles
CC(C)(C)[C@](C)([C@H]1C[C@@]23CC[C@@]1([C@H]4[C@@]25CCN[C@@H]3CC6=C5C(=C(C=C6)O)O4)OC)O
*XLogP
2.9
*Topological Polar Surface Area
71
