5-alpha-Dihydroprogesterone
From DrugPedia: A Wikipedia for Drug discovery
(Difference between revisions)
(→Description) |
|||
| Line 9: | Line 9: | ||
</jmol> | </jmol> | ||
</td></tr></table> | </td></tr></table> | ||
| + | {{Drugbox | ||
| + | | IUPAC_name = (5S,8R,9S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopent[a]phenanthren-3-one | ||
| + | | CAS_number = | ||
| + | | CAS_supplemental = | ||
| + | | ATC_suffix = BA03 | ||
| + | | ATC_supplemental = | ||
| + | | PubChem = 92810 | ||
| + | | ChemSpiderID = | ||
| + | | chemical_formula =C<sub>2</sub><sub>1</sub>H<sub>3</sub><sub>2</sub>O<sub>2</sub> | ||
| + | | molecular_weight = 316.48 | ||
| + | | smiles = CC(=O)C1CCC2C1(CCC3C2CCC4C3(CCC(=O)C4)C)C | ||
| + | | synonyms = Enterolactone | ||
| + | | density = | ||
| + | | melting_point = 200<sup>o</sup>C | ||
| + | | boiling_point = | ||
| + | | solubility = | ||
| + | | specific_rotation = | ||
| + | | sec_combustion = | ||
| + | | bioavailability = | ||
| + | | protein_bound = | ||
| + | | metabolism = | ||
| + | | elimination_half-life = | ||
| + | | excretion = | ||
| + | | pregnancy_category= | ||
| + | | dependency_liability = | ||
| + | | routes_of_administration = | ||
| + | }} | ||
| + | [http://172.141.127.22/raghava/hmrbase/test_extract.php?db=arun&table=nphormonet&id=1003&show=SHOW-3D Show 3-D Structure] | ||
==Description== | ==Description== | ||
A biologically active 5-alpha-reduced metabolite of plasma PROGESTERONE. It is the immediate precursor of 5-alpha-pregnan-3-alpha-ol-20-one (ALLOPREGNANOLONE), a neuroactive steroid that binds with GABA(A) RECEPTOR. | A biologically active 5-alpha-reduced metabolite of plasma PROGESTERONE. It is the immediate precursor of 5-alpha-pregnan-3-alpha-ol-20-one (ALLOPREGNANOLONE), a neuroactive steroid that binds with GABA(A) RECEPTOR. | ||
| - | + | ||
==General Properties== | ==General Properties== | ||
| Line 46: | Line 74: | ||
3.46(EST) | 3.46(EST) | ||
| - | |||
Revision as of 09:48, 19 February 2009
|
|
| 5-alpha-Dihydroprogesterone
| |
| Systematic (IUPAC) name | |
| (5S,8R,9S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopent[a]phenanthren-3-one | |
| Identifiers | |
| CAS number | ? |
| ATC code | ? |
| PubChem | |
| Chemical data | |
| Formula | C21H32O2 |
| Mol. mass | 316.48 |
| SMILES | & |
| Synonyms | Enterolactone |
| Physical data | |
| Melt. point | 200oC °C |
| Pharmacokinetic data | |
| Bioavailability | ? |
| Metabolism | ? |
| Half life | ? |
| Excretion | ? |
| Therapeutic considerations | |
| Pregnancy cat. |
? |
| Legal status | |
| Routes | ? |
Contents |
Description
A biologically active 5-alpha-reduced metabolite of plasma PROGESTERONE. It is the immediate precursor of 5-alpha-pregnan-3-alpha-ol-20-one (ALLOPREGNANOLONE), a neuroactive steroid that binds with GABA(A) RECEPTOR.
General Properties
*Molecular Weight
316.48
*Molecular Formula
C21H32O2
*IUPAC NAME
(5S,8R,9S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one
*Canonical Smiles
CC(=O)C1CCC2C1(CCC3C2CCC4C3(CCC(=O)C4)C)C
*Isomeric Smiles
CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(CCC(=O)C4)C)C
PhysioChemical Properties
*Melting Point
200(EXP)
*LogP
3.46(EST)
